C26H30N4O4S — CID 45169785
4-[4-(4-acetylpiperazine-1-carbonyl)piperidin-1-yl]-2-(1-thiophen-2-ylethyl)isoindole-1,3-dione (PubChem CID 45169785) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is 4-[4-(4-acetylpiperazine-1-carbonyl)piperidin-1-yl]-2-(1-thiophen-2-ylethyl)isoindole-1,3-dione.
| Compound Name | 4-[4-(4-acetylpiperazine-1-carbonyl)piperidin-1-yl]-2-(1-thiophen-2-ylethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 45169785 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 4-[4-(4-acetylpiperazine-1-carbonyl)piperidin-1-yl]-2-(1-thiophen-2-ylethyl)isoindole-1,3-dione |
| SMILES | CC(=O)N1CCN(C(=O)C2CCN(c3cccc4c3C(=O)N(C(C)c3cccs3)C4=O)CC2)CC1 |
| InChI | InChI=1S/C26H30N4O4S/c1-17(22-7-4-16-35-22)30-25(33)20-5-3-6-21(23(20)26(30)34)28-10-8-19(9-11-28)24(32)29-14-12-27(13-15-29)18(2)31/h3-7,16-17,19H,8-15H2,1-2H3 |
| InChIKey | FZRJMTRTHKLIRA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|