C25H30N4O3S — CID 45210438
4-[3-(azepane-1-carbonyl)piperidin-1-yl]-2-[1-(1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione (PubChem CID 45210438) has the molecular formula C25H30N4O3S and a molecular weight of 466.61 g/mol. Its IUPAC name is 4-[3-(azepane-1-carbonyl)piperidin-1-yl]-2-[1-(1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 4-[3-(azepane-1-carbonyl)piperidin-1-yl]-2-[1-(1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45210438 |
| Molecular Formula | C25H30N4O3S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 4-[3-(azepane-1-carbonyl)piperidin-1-yl]-2-[1-(1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione |
| SMILES | CC(c1nccs1)N1C(=O)c2cccc(N3CCCC(C(=O)N4CCCCCC4)C3)c2C1=O |
| InChI | InChI=1S/C25H30N4O3S/c1-17(22-26-11-15-33-22)29-24(31)19-9-6-10-20(21(19)25(29)32)28-14-7-8-18(16-28)23(30)27-12-4-2-3-5-13-27/h6,9-11,15,17-18H,2-5,7-8,12-14,16H2,1H3 |
| InChIKey | LTVMAKWWQZIULB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|