C24H28N4O3S — CID 26353798
4-[(3S)-3-[(3R)-3-methylpiperidine-1-carbonyl]piperidin-1-yl]-2-(1,3-thiazol-2-ylmethyl)isoindole-1,3-dione (PubChem CID 26353798) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is 4-[(3S)-3-[(3R)-3-methylpiperidine-1-carbonyl]piperidin-1-yl]-2-(1,3-thiazol-2-ylmethyl)isoindole-1,3-dione.
| Compound Name | 4-[(3S)-3-[(3R)-3-methylpiperidine-1-carbonyl]piperidin-1-yl]-2-(1,3-thiazol-2-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 26353798 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 4-[(3S)-3-[(3R)-3-methylpiperidine-1-carbonyl]piperidin-1-yl]-2-(1,3-thiazol-2-ylmethyl)isoindole-1,3-dione |
| SMILES | C[C@@H]1CCCN(C(=O)[C@H]2CCCN(c3cccc4c3C(=O)N(Cc3nccs3)C4=O)C2)C1 |
| InChI | InChI=1S/C24H28N4O3S/c1-16-5-3-11-27(13-16)22(29)17-6-4-10-26(14-17)19-8-2-7-18-21(19)24(31)28(23(18)30)15-20-25-9-12-32-20/h2,7-9,12,16-17H,3-6,10-11,13-15H2,1H3/t16-,17+/m1/s1 |
| InChIKey | APEOFGFBPIIFNX-SJORKVTESA-N |
| XLogP | 3.41 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|