C25H26N4O3S2 — CID 45199213
1-[1,3-dioxo-2-(1,3-thiazol-2-ylmethyl)isoindol-4-yl]-N-methyl-N-(1-thiophen-2-ylethyl)piperidine-3-carboxamide (PubChem CID 45199213) has the molecular formula C25H26N4O3S2 and a molecular weight of 494.64 g/mol. Its IUPAC name is 1-[1,3-dioxo-2-(1,3-thiazol-2-ylmethyl)isoindol-4-yl]-N-methyl-N-(1-thiophen-2-ylethyl)piperidine-3-carboxamide.
| Compound Name | 1-[1,3-dioxo-2-(1,3-thiazol-2-ylmethyl)isoindol-4-yl]-N-methyl-N-(1-thiophen-2-ylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45199213 |
| Molecular Formula | C25H26N4O3S2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 1-[1,3-dioxo-2-(1,3-thiazol-2-ylmethyl)isoindol-4-yl]-N-methyl-N-(1-thiophen-2-ylethyl)piperidine-3-carboxamide |
| SMILES | CC(c1cccs1)N(C)C(=O)C1CCCN(c2cccc3c2C(=O)N(Cc2nccs2)C3=O)C1 |
| InChI | InChI=1S/C25H26N4O3S2/c1-16(20-9-5-12-33-20)27(2)23(30)17-6-4-11-28(14-17)19-8-3-7-18-22(19)25(32)29(24(18)31)15-21-26-10-13-34-21/h3,5,7-10,12-13,16-17H,4,6,11,14-15H2,1-2H3 |
| InChIKey | APWGQNPBQABMKO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|