C26H31N3O3S — CID 118755329
N-(cyclopropylmethyl)-1-[1,3-dioxo-2-(thiophen-2-ylmethyl)isoindol-4-yl]-N-propylpiperidine-3-carboxamide (PubChem CID 118755329) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-[1,3-dioxo-2-(thiophen-2-ylmethyl)isoindol-4-yl]-N-propylpiperidine-3-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-1-[1,3-dioxo-2-(thiophen-2-ylmethyl)isoindol-4-yl]-N-propylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 118755329 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | N-(cyclopropylmethyl)-1-[1,3-dioxo-2-(thiophen-2-ylmethyl)isoindol-4-yl]-N-propylpiperidine-3-carboxamide |
| SMILES | CCCN(CC1CC1)C(=O)C1CCCN(c2cccc3c2C(=O)N(Cc2cccs2)C3=O)C1 |
| InChI | InChI=1S/C26H31N3O3S/c1-2-12-28(15-18-10-11-18)24(30)19-6-4-13-27(16-19)22-9-3-8-21-23(22)26(32)29(25(21)31)17-20-7-5-14-33-20/h3,5,7-9,14,18-19H,2,4,6,10-13,15-17H2,1H3 |
| InChIKey | KXMKCDMYPZUHBY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|