C27H29N5O4 — CID 45247822
N-benzyl-N-ethyl-1-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-1,3-dioxoisoindol-4-yl]piperidine-3-carboxamide (PubChem CID 45247822) has the molecular formula C27H29N5O4 and a molecular weight of 487.56 g/mol. Its IUPAC name is N-benzyl-N-ethyl-1-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-1,3-dioxoisoindol-4-yl]piperidine-3-carboxamide.
| Compound Name | N-benzyl-N-ethyl-1-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-1,3-dioxoisoindol-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45247822 |
| Molecular Formula | C27H29N5O4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | N-benzyl-N-ethyl-1-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-1,3-dioxoisoindol-4-yl]piperidine-3-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C1CCCN(c2cccc3c2C(=O)N(Cc2nonc2C)C3=O)C1 |
| InChI | InChI=1S/C27H29N5O4/c1-3-30(15-19-9-5-4-6-10-19)25(33)20-11-8-14-31(16-20)23-13-7-12-21-24(23)27(35)32(26(21)34)17-22-18(2)28-36-29-22/h4-7,9-10,12-13,20H,3,8,11,14-17H2,1-2H3 |
| InChIKey | HEJGKAPCCYDATF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 99.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|