C26H31N3O4 — CID 42480022
(3R)-N-benzyl-1-[2-(3-methoxypropyl)-1,3-dioxoisoindol-4-yl]-N-methylpiperidine-3-carboxamide (PubChem CID 42480022) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is (3R)-N-benzyl-1-[2-(3-methoxypropyl)-1,3-dioxoisoindol-4-yl]-N-methylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-benzyl-1-[2-(3-methoxypropyl)-1,3-dioxoisoindol-4-yl]-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42480022 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | (3R)-N-benzyl-1-[2-(3-methoxypropyl)-1,3-dioxoisoindol-4-yl]-N-methylpiperidine-3-carboxamide |
| SMILES | COCCCN1C(=O)c2cccc(N3CCC[C@@H](C(=O)N(C)Cc4ccccc4)C3)c2C1=O |
| InChI | InChI=1S/C26H31N3O4/c1-27(17-19-9-4-3-5-10-19)24(30)20-11-7-14-28(18-20)22-13-6-12-21-23(22)26(32)29(25(21)31)15-8-16-33-2/h3-6,9-10,12-13,20H,7-8,11,14-18H2,1-2H3/t20-/m1/s1 |
| InChIKey | VXZOMIYEOGOZDO-HXUWFJFHSA-N |
| XLogP | 3.19 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|