C28H29N3O3S — CID 125173671
(3S)-N-benzyl-1-[1,3-dioxo-2-[(1S)-1-thiophen-2-ylethyl]isoindol-4-yl]-N-methylpiperidine-3-carboxamide (PubChem CID 125173671) has the molecular formula C28H29N3O3S and a molecular weight of 487.63 g/mol. Its IUPAC name is (3S)-N-benzyl-1-[1,3-dioxo-2-[(1S)-1-thiophen-2-ylethyl]isoindol-4-yl]-N-methylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-benzyl-1-[1,3-dioxo-2-[(1S)-1-thiophen-2-ylethyl]isoindol-4-yl]-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 125173671 |
| Molecular Formula | C28H29N3O3S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | (3S)-N-benzyl-1-[1,3-dioxo-2-[(1S)-1-thiophen-2-ylethyl]isoindol-4-yl]-N-methylpiperidine-3-carboxamide |
| SMILES | C[C@@H](c1cccs1)N1C(=O)c2cccc(N3CCC[C@H](C(=O)N(C)Cc4ccccc4)C3)c2C1=O |
| InChI | InChI=1S/C28H29N3O3S/c1-19(24-14-8-16-35-24)31-27(33)22-12-6-13-23(25(22)28(31)34)30-15-7-11-21(18-30)26(32)29(2)17-20-9-4-3-5-10-20/h3-6,8-10,12-14,16,19,21H,7,11,15,17-18H2,1-2H3/t19-,21-/m0/s1 |
| InChIKey | CPJYTZFANXGWOL-FPOVZHCZSA-N |
| XLogP | 4.98 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|