C28H27N3O5S — CID 125169409
(3R)-N-(1,3-benzodioxol-5-ylmethyl)-1-[1,3-dioxo-2-[(1S)-1-thiophen-2-ylethyl]isoindol-4-yl]piperidine-3-carboxamide (PubChem CID 125169409) has the molecular formula C28H27N3O5S and a molecular weight of 517.61 g/mol. Its IUPAC name is (3R)-N-(1,3-benzodioxol-5-ylmethyl)-1-[1,3-dioxo-2-[(1S)-1-thiophen-2-ylethyl]isoindol-4-yl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-(1,3-benzodioxol-5-ylmethyl)-1-[1,3-dioxo-2-[(1S)-1-thiophen-2-ylethyl]isoindol-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 125169409 |
| Molecular Formula | C28H27N3O5S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | (3R)-N-(1,3-benzodioxol-5-ylmethyl)-1-[1,3-dioxo-2-[(1S)-1-thiophen-2-ylethyl]isoindol-4-yl]piperidine-3-carboxamide |
| SMILES | C[C@@H](c1cccs1)N1C(=O)c2cccc(N3CCC[C@@H](C(=O)NCc4ccc5c(c4)OCO5)C3)c2C1=O |
| InChI | InChI=1S/C28H27N3O5S/c1-17(24-8-4-12-37-24)31-27(33)20-6-2-7-21(25(20)28(31)34)30-11-3-5-19(15-30)26(32)29-14-18-9-10-22-23(13-18)36-16-35-22/h2,4,6-10,12-13,17,19H,3,5,11,14-16H2,1H3,(H,29,32)/t17-,19+/m0/s1 |
| InChIKey | WYWDBSRBZBXJLW-PKOBYXMFSA-N |
| XLogP | 4.37 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|