C26H26N4O3S — CID 45241845
N-benzyl-1-[1,3-dioxo-2-[1-(1,3-thiazol-2-yl)ethyl]isoindol-4-yl]piperidine-3-carboxamide (PubChem CID 45241845) has the molecular formula C26H26N4O3S and a molecular weight of 474.59 g/mol. Its IUPAC name is N-benzyl-1-[1,3-dioxo-2-[1-(1,3-thiazol-2-yl)ethyl]isoindol-4-yl]piperidine-3-carboxamide.
| Compound Name | N-benzyl-1-[1,3-dioxo-2-[1-(1,3-thiazol-2-yl)ethyl]isoindol-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45241845 |
| Molecular Formula | C26H26N4O3S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | N-benzyl-1-[1,3-dioxo-2-[1-(1,3-thiazol-2-yl)ethyl]isoindol-4-yl]piperidine-3-carboxamide |
| SMILES | CC(c1nccs1)N1C(=O)c2cccc(N3CCCC(C(=O)NCc4ccccc4)C3)c2C1=O |
| InChI | InChI=1S/C26H26N4O3S/c1-17(24-27-12-14-34-24)30-25(32)20-10-5-11-21(22(20)26(30)33)29-13-6-9-19(16-29)23(31)28-15-18-7-3-2-4-8-18/h2-5,7-8,10-12,14,17,19H,6,9,13,15-16H2,1H3,(H,28,31) |
| InChIKey | YLHIWUBGHVEPKO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|