C27H29N5O3 — CID 26355845
(3S)-1-[1,3-dioxo-2-(2-pyrazol-1-ylethyl)isoindol-4-yl]-N-[(4-methylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 26355845) has the molecular formula C27H29N5O3 and a molecular weight of 471.56 g/mol. Its IUPAC name is (3S)-1-[1,3-dioxo-2-(2-pyrazol-1-ylethyl)isoindol-4-yl]-N-[(4-methylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[1,3-dioxo-2-(2-pyrazol-1-ylethyl)isoindol-4-yl]-N-[(4-methylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 26355845 |
| Molecular Formula | C27H29N5O3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | (3S)-1-[1,3-dioxo-2-(2-pyrazol-1-ylethyl)isoindol-4-yl]-N-[(4-methylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(CNC(=O)[C@H]2CCCN(c3cccc4c3C(=O)N(CCn3cccn3)C4=O)C2)cc1 |
| InChI | InChI=1S/C27H29N5O3/c1-19-8-10-20(11-9-19)17-28-25(33)21-5-3-13-30(18-21)23-7-2-6-22-24(23)27(35)32(26(22)34)16-15-31-14-4-12-29-31/h2,4,6-12,14,21H,3,5,13,15-18H2,1H3,(H,28,33)/t21-/m0/s1 |
| InChIKey | VVGCHLJUNKVJQV-NRFANRHFSA-N |
| XLogP | 3.02 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|