C26H32N4O3S — CID 42480164
(3R)-N-cyclohexyl-1-[1,3-dioxo-2-[(1S)-1-(1,3-thiazol-2-yl)ethyl]isoindol-4-yl]-N-methylpiperidine-3-carboxamide (PubChem CID 42480164) has the molecular formula C26H32N4O3S and a molecular weight of 480.63 g/mol. Its IUPAC name is (3R)-N-cyclohexyl-1-[1,3-dioxo-2-[(1S)-1-(1,3-thiazol-2-yl)ethyl]isoindol-4-yl]-N-methylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-cyclohexyl-1-[1,3-dioxo-2-[(1S)-1-(1,3-thiazol-2-yl)ethyl]isoindol-4-yl]-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42480164 |
| Molecular Formula | C26H32N4O3S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | (3R)-N-cyclohexyl-1-[1,3-dioxo-2-[(1S)-1-(1,3-thiazol-2-yl)ethyl]isoindol-4-yl]-N-methylpiperidine-3-carboxamide |
| SMILES | C[C@@H](c1nccs1)N1C(=O)c2cccc(N3CCC[C@@H](C(=O)N(C)C4CCCCC4)C3)c2C1=O |
| InChI | InChI=1S/C26H32N4O3S/c1-17(23-27-13-15-34-23)30-25(32)20-11-6-12-21(22(20)26(30)33)29-14-7-8-18(16-29)24(31)28(2)19-9-4-3-5-10-19/h6,11-13,15,17-19H,3-5,7-10,14,16H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | KJVHZOTXTGFNMW-ZWKOTPCHSA-N |
| XLogP | 4.51 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|