C30H33N5O3S — CID 98296819
4-[4-[4-(4-methylphenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-[(1S)-1-(1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione (PubChem CID 98296819) has the molecular formula C30H33N5O3S and a molecular weight of 543.69 g/mol. Its IUPAC name is 4-[4-[4-(4-methylphenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-[(1S)-1-(1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 4-[4-[4-(4-methylphenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-[(1S)-1-(1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 98296819 |
| Molecular Formula | C30H33N5O3S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 4-[4-[4-(4-methylphenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-[(1S)-1-(1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(N2CCN(C(=O)C3CCN(c4cccc5c4C(=O)N([C@@H](C)c4nccs4)C5=O)CC3)CC2)cc1 |
| InChI | InChI=1S/C30H33N5O3S/c1-20-6-8-23(9-7-20)32-15-17-34(18-16-32)28(36)22-10-13-33(14-11-22)25-5-3-4-24-26(25)30(38)35(29(24)37)21(2)27-31-12-19-39-27/h3-9,12,19,21-22H,10-11,13-18H2,1-2H3/t21-/m0/s1 |
| InChIKey | BGDXTVJQUROQFP-NRFANRHFSA-N |
| XLogP | 4.37 |
| TPSA | 77.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|