C30H33N5O3S — CID 45171553
4-[3-[4-(2,5-dimethylphenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-(1,3-thiazol-2-ylmethyl)isoindole-1,3-dione (PubChem CID 45171553) has the molecular formula C30H33N5O3S and a molecular weight of 543.69 g/mol. Its IUPAC name is 4-[3-[4-(2,5-dimethylphenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-(1,3-thiazol-2-ylmethyl)isoindole-1,3-dione.
| Compound Name | 4-[3-[4-(2,5-dimethylphenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-(1,3-thiazol-2-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 45171553 |
| Molecular Formula | C30H33N5O3S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 4-[3-[4-(2,5-dimethylphenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-(1,3-thiazol-2-ylmethyl)isoindole-1,3-dione |
| SMILES | Cc1ccc(C)c(N2CCN(C(=O)C3CCCN(c4cccc5c4C(=O)N(Cc4nccs4)C5=O)C3)CC2)c1 |
| InChI | InChI=1S/C30H33N5O3S/c1-20-8-9-21(2)25(17-20)32-12-14-33(15-13-32)28(36)22-5-4-11-34(18-22)24-7-3-6-23-27(24)30(38)35(29(23)37)19-26-31-10-16-39-26/h3,6-10,16-17,22H,4-5,11-15,18-19H2,1-2H3 |
| InChIKey | QQRNAYWDUGSLPS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 77.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|