C26H26N4O3S2 — CID 45187792
2-(1,3-benzothiazol-2-ylmethyl)-4-[3-(thiomorpholine-4-carbonyl)piperidin-1-yl]isoindole-1,3-dione (PubChem CID 45187792) has the molecular formula C26H26N4O3S2 and a molecular weight of 506.65 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethyl)-4-[3-(thiomorpholine-4-carbonyl)piperidin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethyl)-4-[3-(thiomorpholine-4-carbonyl)piperidin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45187792 |
| Molecular Formula | C26H26N4O3S2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethyl)-4-[3-(thiomorpholine-4-carbonyl)piperidin-1-yl]isoindole-1,3-dione |
| SMILES | O=C(C1CCCN(c2cccc3c2C(=O)N(Cc2nc4ccccc4s2)C3=O)C1)N1CCSCC1 |
| InChI | InChI=1S/C26H26N4O3S2/c31-24(28-11-13-34-14-12-28)17-5-4-10-29(15-17)20-8-3-6-18-23(20)26(33)30(25(18)32)16-22-27-19-7-1-2-9-21(19)35-22/h1-3,6-9,17H,4-5,10-16H2 |
| InChIKey | AFGGIHZAHNKJEX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|