C28H30N4O3S — CID 45179387
2-(1,3-benzothiazol-2-ylmethyl)-4-[3-(2-methylpiperidine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione (PubChem CID 45179387) has the molecular formula C28H30N4O3S and a molecular weight of 502.64 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethyl)-4-[3-(2-methylpiperidine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethyl)-4-[3-(2-methylpiperidine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45179387 |
| Molecular Formula | C28H30N4O3S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethyl)-4-[3-(2-methylpiperidine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione |
| SMILES | CC1CCCCN1C(=O)C1CCCN(c2cccc3c2C(=O)N(Cc2nc4ccccc4s2)C3=O)C1 |
| InChI | InChI=1S/C28H30N4O3S/c1-18-8-4-5-15-31(18)26(33)19-9-7-14-30(16-19)22-12-6-10-20-25(22)28(35)32(27(20)34)17-24-29-21-11-2-3-13-23(21)36-24/h2-3,6,10-13,18-19H,4-5,7-9,14-17H2,1H3 |
| InChIKey | IANFOUSNWYQPQG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|