C27H27N3O5S2 — CID 125160748
(3S)-1-[2-(1-benzothiophen-2-ylmethyl)-1,3-dioxoisoindol-4-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]piperidine-3-carboxamide (PubChem CID 125160748) has the molecular formula C27H27N3O5S2 and a molecular weight of 537.66 g/mol. Its IUPAC name is (3S)-1-[2-(1-benzothiophen-2-ylmethyl)-1,3-dioxoisoindol-4-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[2-(1-benzothiophen-2-ylmethyl)-1,3-dioxoisoindol-4-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 125160748 |
| Molecular Formula | C27H27N3O5S2 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | (3S)-1-[2-(1-benzothiophen-2-ylmethyl)-1,3-dioxoisoindol-4-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]piperidine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCS(=O)(=O)C1)[C@H]1CCCN(c2cccc3c2C(=O)N(Cc2cc4ccccc4s2)C3=O)C1 |
| InChI | InChI=1S/C27H27N3O5S2/c31-25(28-19-10-12-37(34,35)16-19)18-6-4-11-29(14-18)22-8-3-7-21-24(22)27(33)30(26(21)32)15-20-13-17-5-1-2-9-23(17)36-20/h1-3,5,7-9,13,18-19H,4,6,10-12,14-16H2,(H,28,31)/t18-,19+/m0/s1 |
| InChIKey | AMUULVBFPNRUEZ-RBUKOAKNSA-N |
| XLogP | 3.22 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|