C33H31N5O5 — CID 98343818
4-[(3R)-3-[4-(furan-2-carbonyl)piperazine-1-carbonyl]piperidin-1-yl]-2-(quinolin-3-ylmethyl)isoindole-1,3-dione (PubChem CID 98343818) has the molecular formula C33H31N5O5 and a molecular weight of 577.64 g/mol. Its IUPAC name is 4-[(3R)-3-[4-(furan-2-carbonyl)piperazine-1-carbonyl]piperidin-1-yl]-2-(quinolin-3-ylmethyl)isoindole-1,3-dione.
| Compound Name | 4-[(3R)-3-[4-(furan-2-carbonyl)piperazine-1-carbonyl]piperidin-1-yl]-2-(quinolin-3-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 98343818 |
| Molecular Formula | C33H31N5O5 |
| Molecular Weight | 577.64 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | 4-[(3R)-3-[4-(furan-2-carbonyl)piperazine-1-carbonyl]piperidin-1-yl]-2-(quinolin-3-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C(c1ccco1)N1CCN(C(=O)[C@@H]2CCCN(c3cccc4c3C(=O)N(Cc3cnc5ccccc5c3)C4=O)C2)CC1 |
| InChI | InChI=1S/C33H31N5O5/c39-30(35-13-15-36(16-14-35)32(41)28-11-5-17-43-28)24-7-4-12-37(21-24)27-10-3-8-25-29(27)33(42)38(31(25)40)20-22-18-23-6-1-2-9-26(23)34-19-22/h1-3,5-6,8-11,17-19,24H,4,7,12-16,20-21H2/t24-/m1/s1 |
| InChIKey | FCDBMBMUMDXZGG-XMMPIXPASA-N |
| XLogP | 3.83 |
| TPSA | 107.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.64 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|