C23H20N4O4 — CID 56859365
4-[4-(furan-2-carbonyl)piperazin-1-yl]-2-(pyridin-4-ylmethyl)isoindole-1,3-dione (PubChem CID 56859365) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is 4-[4-(furan-2-carbonyl)piperazin-1-yl]-2-(pyridin-4-ylmethyl)isoindole-1,3-dione.
| Compound Name | 4-[4-(furan-2-carbonyl)piperazin-1-yl]-2-(pyridin-4-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 56859365 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 4-[4-(furan-2-carbonyl)piperazin-1-yl]-2-(pyridin-4-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C(c1ccco1)N1CCN(c2cccc3c2C(=O)N(Cc2ccncc2)C3=O)CC1 |
| InChI | InChI=1S/C23H20N4O4/c28-21-17-3-1-4-18(20(17)23(30)27(21)15-16-6-8-24-9-7-16)25-10-12-26(13-11-25)22(29)19-5-2-14-31-19/h1-9,14H,10-13,15H2 |
| InChIKey | LGGZDORMQMOEPV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|