C26H23ClN4O4 — CID 42484305
4-[4-[(2R)-2-(2-chlorophenyl)-2-hydroxyacetyl]piperazin-1-yl]-2-(pyridin-3-ylmethyl)isoindole-1,3-dione (PubChem CID 42484305) has the molecular formula C26H23ClN4O4 and a molecular weight of 490.95 g/mol. Its IUPAC name is 4-[4-[(2R)-2-(2-chlorophenyl)-2-hydroxyacetyl]piperazin-1-yl]-2-(pyridin-3-ylmethyl)isoindole-1,3-dione.
| Compound Name | 4-[4-[(2R)-2-(2-chlorophenyl)-2-hydroxyacetyl]piperazin-1-yl]-2-(pyridin-3-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 42484305 |
| Molecular Formula | C26H23ClN4O4 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 4-[4-[(2R)-2-(2-chlorophenyl)-2-hydroxyacetyl]piperazin-1-yl]-2-(pyridin-3-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C([C@H](O)c1ccccc1Cl)N1CCN(c2cccc3c2C(=O)N(Cc2cccnc2)C3=O)CC1 |
| InChI | InChI=1S/C26H23ClN4O4/c27-20-8-2-1-6-18(20)23(32)26(35)30-13-11-29(12-14-30)21-9-3-7-19-22(21)25(34)31(24(19)33)16-17-5-4-10-28-15-17/h1-10,15,23,32H,11-14,16H2/t23-/m1/s1 |
| InChIKey | XFUMHMKCBWCYRM-HSZRJFAPSA-N |
| XLogP | 2.91 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|