C20H23N5O3 — CID 126464278
4-(4-acetylpiperazin-1-yl)-2-[(1,5-dimethylpyrazol-4-yl)methyl]isoindole-1,3-dione (PubChem CID 126464278) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-2-[(1,5-dimethylpyrazol-4-yl)methyl]isoindole-1,3-dione.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-2-[(1,5-dimethylpyrazol-4-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 126464278 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-2-[(1,5-dimethylpyrazol-4-yl)methyl]isoindole-1,3-dione |
| SMILES | CC(=O)N1CCN(c2cccc3c2C(=O)N(Cc2cnn(C)c2C)C3=O)CC1 |
| InChI | InChI=1S/C20H23N5O3/c1-13-15(11-21-22(13)3)12-25-19(27)16-5-4-6-17(18(16)20(25)28)24-9-7-23(8-10-24)14(2)26/h4-6,11H,7-10,12H2,1-3H3 |
| InChIKey | LDPHCHNONFZLBR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|