C25H24FN5O3 — CID 42273706
2-[(1,5-dimethylpyrazol-4-yl)methyl]-4-[4-(3-fluorobenzoyl)piperazin-1-yl]isoindole-1,3-dione (PubChem CID 42273706) has the molecular formula C25H24FN5O3 and a molecular weight of 461.50 g/mol. Its IUPAC name is 2-[(1,5-dimethylpyrazol-4-yl)methyl]-4-[4-(3-fluorobenzoyl)piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(1,5-dimethylpyrazol-4-yl)methyl]-4-[4-(3-fluorobenzoyl)piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42273706 |
| Molecular Formula | C25H24FN5O3 |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 2-[(1,5-dimethylpyrazol-4-yl)methyl]-4-[4-(3-fluorobenzoyl)piperazin-1-yl]isoindole-1,3-dione |
| SMILES | Cc1c(CN2C(=O)c3cccc(N4CCN(C(=O)c5cccc(F)c5)CC4)c3C2=O)cnn1C |
| InChI | InChI=1S/C25H24FN5O3/c1-16-18(14-27-28(16)2)15-31-24(33)20-7-4-8-21(22(20)25(31)34)29-9-11-30(12-10-29)23(32)17-5-3-6-19(26)13-17/h3-8,13-14H,9-12,15H2,1-2H3 |
| InChIKey | GBWXRSFEEAOBII-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|