C27H29N5O4 — CID 42171602
2-[(1,5-dimethylpyrazol-4-yl)methyl]-4-[4-[2-(2-methoxyphenyl)acetyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 42171602) has the molecular formula C27H29N5O4 and a molecular weight of 487.56 g/mol. Its IUPAC name is 2-[(1,5-dimethylpyrazol-4-yl)methyl]-4-[4-[2-(2-methoxyphenyl)acetyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(1,5-dimethylpyrazol-4-yl)methyl]-4-[4-[2-(2-methoxyphenyl)acetyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42171602 |
| Molecular Formula | C27H29N5O4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 2-[(1,5-dimethylpyrazol-4-yl)methyl]-4-[4-[2-(2-methoxyphenyl)acetyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | COc1ccccc1CC(=O)N1CCN(c2cccc3c2C(=O)N(Cc2cnn(C)c2C)C3=O)CC1 |
| InChI | InChI=1S/C27H29N5O4/c1-18-20(16-28-29(18)2)17-32-26(34)21-8-6-9-22(25(21)27(32)35)30-11-13-31(14-12-30)24(33)15-19-7-4-5-10-23(19)36-3/h4-10,16H,11-15,17H2,1-3H3 |
| InChIKey | ICZTXOFMCFBZBF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 87.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|