C26H29N3O6 — CID 45199574
2-[(2,3-dimethoxyphenyl)methyl]-4-[4-(oxolane-2-carbonyl)piperazin-1-yl]isoindole-1,3-dione (PubChem CID 45199574) has the molecular formula C26H29N3O6 and a molecular weight of 479.53 g/mol. Its IUPAC name is 2-[(2,3-dimethoxyphenyl)methyl]-4-[4-(oxolane-2-carbonyl)piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2,3-dimethoxyphenyl)methyl]-4-[4-(oxolane-2-carbonyl)piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45199574 |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 2-[(2,3-dimethoxyphenyl)methyl]-4-[4-(oxolane-2-carbonyl)piperazin-1-yl]isoindole-1,3-dione |
| SMILES | COc1cccc(CN2C(=O)c3cccc(N4CCN(C(=O)C5CCCO5)CC4)c3C2=O)c1OC |
| InChI | InChI=1S/C26H29N3O6/c1-33-20-9-3-6-17(23(20)34-2)16-29-24(30)18-7-4-8-19(22(18)26(29)32)27-11-13-28(14-12-27)25(31)21-10-5-15-35-21/h3-4,6-9,21H,5,10-16H2,1-2H3 |
| InChIKey | QNNHDQSRIAMKES-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|