C25H29N3O5 — CID 56855976
4-[4-[(3-hydroxy-4-methoxyphenyl)methyl]piperazin-1-yl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione (PubChem CID 56855976) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is 4-[4-[(3-hydroxy-4-methoxyphenyl)methyl]piperazin-1-yl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione.
| Compound Name | 4-[4-[(3-hydroxy-4-methoxyphenyl)methyl]piperazin-1-yl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 56855976 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 4-[4-[(3-hydroxy-4-methoxyphenyl)methyl]piperazin-1-yl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione |
| SMILES | COc1ccc(CN2CCN(c3cccc4c3C(=O)N(CC3CCCO3)C4=O)CC2)cc1O |
| InChI | InChI=1S/C25H29N3O5/c1-32-22-8-7-17(14-21(22)29)15-26-9-11-27(12-10-26)20-6-2-5-19-23(20)25(31)28(24(19)30)16-18-4-3-13-33-18/h2,5-8,14,18,29H,3-4,9-13,15-16H2,1H3 |
| InChIKey | RIPVITNYVDQRPR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|