C24H26FN3O3 — CID 45214087
4-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione (PubChem CID 45214087) has the molecular formula C24H26FN3O3 and a molecular weight of 423.49 g/mol. Its IUPAC name is 4-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione.
| Compound Name | 4-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 45214087 |
| Molecular Formula | C24H26FN3O3 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 4-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C1c2cccc(N3CCN(Cc4cccc(F)c4)CC3)c2C(=O)N1CC1CCCO1 |
| InChI | InChI=1S/C24H26FN3O3/c25-18-5-1-4-17(14-18)15-26-9-11-27(12-10-26)21-8-2-7-20-22(21)24(30)28(23(20)29)16-19-6-3-13-31-19/h1-2,4-5,7-8,14,19H,3,6,9-13,15-16H2 |
| InChIKey | JXEKIDWIUQEJSF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|