C25H24FN3O3 — CID 26341547
2-[2-(3-fluorophenyl)ethyl]-4-[4-(furan-3-ylmethyl)piperazin-1-yl]isoindole-1,3-dione (PubChem CID 26341547) has the molecular formula C25H24FN3O3 and a molecular weight of 433.48 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)ethyl]-4-[4-(furan-3-ylmethyl)piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-(3-fluorophenyl)ethyl]-4-[4-(furan-3-ylmethyl)piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 26341547 |
| Molecular Formula | C25H24FN3O3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-[2-(3-fluorophenyl)ethyl]-4-[4-(furan-3-ylmethyl)piperazin-1-yl]isoindole-1,3-dione |
| SMILES | O=C1c2cccc(N3CCN(Cc4ccoc4)CC3)c2C(=O)N1CCc1cccc(F)c1 |
| InChI | InChI=1S/C25H24FN3O3/c26-20-4-1-3-18(15-20)7-9-29-24(30)21-5-2-6-22(23(21)25(29)31)28-12-10-27(11-13-28)16-19-8-14-32-17-19/h1-6,8,14-15,17H,7,9-13,16H2 |
| InChIKey | POHWQCFWKIOLPU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|