C28H26FN3O4 — CID 42272800
2-[2-(4-fluorophenyl)ethyl]-4-[4-[(2S)-2-hydroxy-2-phenylacetyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 42272800) has the molecular formula C28H26FN3O4 and a molecular weight of 487.53 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)ethyl]-4-[4-[(2S)-2-hydroxy-2-phenylacetyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-(4-fluorophenyl)ethyl]-4-[4-[(2S)-2-hydroxy-2-phenylacetyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42272800 |
| Molecular Formula | C28H26FN3O4 |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 2-[2-(4-fluorophenyl)ethyl]-4-[4-[(2S)-2-hydroxy-2-phenylacetyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | O=C([C@@H](O)c1ccccc1)N1CCN(c2cccc3c2C(=O)N(CCc2ccc(F)cc2)C3=O)CC1 |
| InChI | InChI=1S/C28H26FN3O4/c29-21-11-9-19(10-12-21)13-14-32-26(34)22-7-4-8-23(24(22)27(32)35)30-15-17-31(18-16-30)28(36)25(33)20-5-2-1-3-6-20/h1-12,25,33H,13-18H2/t25-/m0/s1 |
| InChIKey | KLYYXQSKFDHLHP-VWLOTQADSA-N |
| XLogP | 3.05 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|