C23H26F2N2O3 — CID 89012877
(2S,3R)-6-(4-fluorophenyl)-3-[4-(2-fluorophenyl)piperazine-1-carbonyl]-2-hydroxyhexanal (PubChem CID 89012877) has the molecular formula C23H26F2N2O3 and a molecular weight of 416.47 g/mol. Its IUPAC name is (2S,3R)-6-(4-fluorophenyl)-3-[4-(2-fluorophenyl)piperazine-1-carbonyl]-2-hydroxyhexanal.
| Compound Name | (2S,3R)-6-(4-fluorophenyl)-3-[4-(2-fluorophenyl)piperazine-1-carbonyl]-2-hydroxyhexanal |
|---|---|
| PubChem CID | 89012877 |
| Molecular Formula | C23H26F2N2O3 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (2S,3R)-6-(4-fluorophenyl)-3-[4-(2-fluorophenyl)piperazine-1-carbonyl]-2-hydroxyhexanal |
| SMILES | O=C[C@@H](O)[C@@H](CCCc1ccc(F)cc1)C(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C23H26F2N2O3/c24-18-10-8-17(9-11-18)4-3-5-19(22(29)16-28)23(30)27-14-12-26(13-15-27)21-7-2-1-6-20(21)25/h1-2,6-11,16,19,22,29H,3-5,12-15H2/t19-,22-/m1/s1 |
| InChIKey | FPFSRSVNRMMGLJ-DENIHFKCSA-N |
| XLogP | 2.81 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|