C24H22FN3O2S — CID 42485012
4-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-(thiophen-3-ylmethyl)isoindole-1,3-dione (PubChem CID 42485012) has the molecular formula C24H22FN3O2S and a molecular weight of 435.52 g/mol. Its IUPAC name is 4-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-(thiophen-3-ylmethyl)isoindole-1,3-dione.
| Compound Name | 4-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-(thiophen-3-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 42485012 |
| Molecular Formula | C24H22FN3O2S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 4-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-(thiophen-3-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C1c2cccc(N3CCN(Cc4ccc(F)cc4)CC3)c2C(=O)N1Cc1ccsc1 |
| InChI | InChI=1S/C24H22FN3O2S/c25-19-6-4-17(5-7-19)14-26-9-11-27(12-10-26)21-3-1-2-20-22(21)24(30)28(23(20)29)15-18-8-13-31-16-18/h1-8,13,16H,9-12,14-15H2 |
| InChIKey | DBHRBWJAUKAGHM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|