C24H21F2N3O2S — CID 26279171
4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]-2-(thiophen-3-ylmethyl)isoindole-1,3-dione (PubChem CID 26279171) has the molecular formula C24H21F2N3O2S and a molecular weight of 453.51 g/mol. Its IUPAC name is 4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]-2-(thiophen-3-ylmethyl)isoindole-1,3-dione.
| Compound Name | 4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]-2-(thiophen-3-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 26279171 |
| Molecular Formula | C24H21F2N3O2S |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 4-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]-2-(thiophen-3-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C1c2cccc(N3CCN(Cc4ccc(F)c(F)c4)CC3)c2C(=O)N1Cc1ccsc1 |
| InChI | InChI=1S/C24H21F2N3O2S/c25-19-5-4-16(12-20(19)26)13-27-7-9-28(10-8-27)21-3-1-2-18-22(21)24(31)29(23(18)30)14-17-6-11-32-15-17/h1-6,11-12,15H,7-10,13-14H2 |
| InChIKey | CNNIYXLCNLIXHU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|