C21H20N4O2S2 — CID 42432081
2-(1,3-thiazol-2-ylmethyl)-4-[4-(thiophen-3-ylmethyl)piperazin-1-yl]isoindole-1,3-dione (PubChem CID 42432081) has the molecular formula C21H20N4O2S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-ylmethyl)-4-[4-(thiophen-3-ylmethyl)piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(1,3-thiazol-2-ylmethyl)-4-[4-(thiophen-3-ylmethyl)piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42432081 |
| Molecular Formula | C21H20N4O2S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 2-(1,3-thiazol-2-ylmethyl)-4-[4-(thiophen-3-ylmethyl)piperazin-1-yl]isoindole-1,3-dione |
| SMILES | O=C1c2cccc(N3CCN(Cc4ccsc4)CC3)c2C(=O)N1Cc1nccs1 |
| InChI | InChI=1S/C21H20N4O2S2/c26-20-16-2-1-3-17(19(16)21(27)25(20)13-18-22-5-11-29-18)24-8-6-23(7-9-24)12-15-4-10-28-14-15/h1-5,10-11,14H,6-9,12-13H2 |
| InChIKey | JOQHONAVYKEXKB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|