C25H30N4O3S — CID 45169369
N-cyclohexyl-1-[1,3-dioxo-2-(1,3-thiazol-2-ylmethyl)isoindol-4-yl]-N-methylpiperidine-3-carboxamide (PubChem CID 45169369) has the molecular formula C25H30N4O3S and a molecular weight of 466.61 g/mol. Its IUPAC name is N-cyclohexyl-1-[1,3-dioxo-2-(1,3-thiazol-2-ylmethyl)isoindol-4-yl]-N-methylpiperidine-3-carboxamide.
| Compound Name | N-cyclohexyl-1-[1,3-dioxo-2-(1,3-thiazol-2-ylmethyl)isoindol-4-yl]-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 45169369 |
| Molecular Formula | C25H30N4O3S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N-cyclohexyl-1-[1,3-dioxo-2-(1,3-thiazol-2-ylmethyl)isoindol-4-yl]-N-methylpiperidine-3-carboxamide |
| SMILES | CN(C(=O)C1CCCN(c2cccc3c2C(=O)N(Cc2nccs2)C3=O)C1)C1CCCCC1 |
| InChI | InChI=1S/C25H30N4O3S/c1-27(18-8-3-2-4-9-18)23(30)17-7-6-13-28(15-17)20-11-5-10-19-22(20)25(32)29(24(19)31)16-21-26-12-14-33-21/h5,10-12,14,17-18H,2-4,6-9,13,15-16H2,1H3 |
| InChIKey | JFJCJKAZDLCASJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|