C27H28N4O4 — CID 23627894
2-[(3,4-dimethoxyphenyl)methyl]-4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]isoindole-1,3-dione (PubChem CID 23627894) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23627894 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]isoindole-1,3-dione |
| SMILES | COc1ccc(CN2C(=O)c3cccc(N4CCN(Cc5ccccn5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C27H28N4O4/c1-34-23-10-9-19(16-24(23)35-2)17-31-26(32)21-7-5-8-22(25(21)27(31)33)30-14-12-29(13-15-30)18-20-6-3-4-11-28-20/h3-11,16H,12-15,17-18H2,1-2H3 |
| InChIKey | YFWNJQLZDCCEEP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|