C26H27N3O4S — CID 23627892
2-[(3,4-dimethoxyphenyl)methyl]-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]isoindole-1,3-dione (PubChem CID 23627892) has the molecular formula C26H27N3O4S and a molecular weight of 477.59 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23627892 |
| Molecular Formula | C26H27N3O4S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]isoindole-1,3-dione |
| SMILES | COc1ccc(CN2C(=O)c3cccc(N4CCN(Cc5cccs5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C26H27N3O4S/c1-32-22-9-8-18(15-23(22)33-2)16-29-25(30)20-6-3-7-21(24(20)26(29)31)28-12-10-27(11-13-28)17-19-5-4-14-34-19/h3-9,14-15H,10-13,16-17H2,1-2H3 |
| InChIKey | TUOSMHZMDIQOFF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|