C26H25N3O4S — CID 45246810
2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]isoindole-1,3-dione (PubChem CID 45246810) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45246810 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]isoindole-1,3-dione |
| SMILES | O=C1c2cccc(N3CCN(Cc4cccs4)CC3)c2C(=O)N1CC1COc2ccccc2O1 |
| InChI | InChI=1S/C26H25N3O4S/c30-25-20-6-3-7-21(28-12-10-27(11-13-28)16-19-5-4-14-34-19)24(20)26(31)29(25)15-18-17-32-22-8-1-2-9-23(22)33-18/h1-9,14,18H,10-13,15-17H2 |
| InChIKey | MEORLVQJCHSDFF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|