C17H11Cl2NO4 — CID 40598633
5,6-dichloro-2-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]isoindole-1,3-dione (PubChem CID 40598633) has the molecular formula C17H11Cl2NO4 and a molecular weight of 364.18 g/mol. Its IUPAC name is 5,6-dichloro-2-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]isoindole-1,3-dione.
| Compound Name | 5,6-dichloro-2-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 40598633 |
| Molecular Formula | C17H11Cl2NO4 |
| Molecular Weight | 364.18 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 5,6-dichloro-2-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2cc(Cl)c(Cl)cc2C(=O)N1C[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C17H11Cl2NO4/c18-12-5-10-11(6-13(12)19)17(22)20(16(10)21)7-9-8-23-14-3-1-2-4-15(14)24-9/h1-6,9H,7-8H2/t9-/m1/s1 |
| InChIKey | KTUXCJPUEBWAMP-SECBINFHSA-N |
| XLogP | 3.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.18 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|