About [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methanesulfonyl chloride
[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methanesulfonyl chloride (PubChem CID 98488242) has the molecular formula C9H9ClO4S
and a molecular weight of 248.69 g/mol. Its IUPAC name is [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methanesulfonyl chloride.
Analyze [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methanesulfonyl chloride?
The IUPAC name of [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methanesulfonyl chloride (CID 98488242) is [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methanesulfonyl chloride.
What is the SMILES notation for [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methanesulfonyl chloride?
The canonical SMILES for [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methanesulfonyl chloride is O=S(=O)(Cl)C[C@@H]1COc2ccccc2O1.
What is the InChIKey of [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methanesulfonyl chloride?
The InChIKey is FPDPLSQAWVJKJD-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H9ClO4S/c10-15(11,12)6-7-5-13-8-3-1-2-4-9(8)14-7/h1-4,7H,5-6H2/t7-/m0/s1.
What are the key properties of [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methanesulfonyl chloride?
[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methanesulfonyl chloride has a molecular weight of 248.69 g/mol, XLogP of 1.39, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methanesulfonyl chloride is sourced from PubChem (CID 98488242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).