C11H18N2O4S — CID 91396275
ethane;(3S)-3-[(sulfamoylamino)methyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 91396275) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is ethane;(3S)-3-[(sulfamoylamino)methyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | ethane;(3S)-3-[(sulfamoylamino)methyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 91396275 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | ethane;(3S)-3-[(sulfamoylamino)methyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | CC.NS(=O)(=O)NC[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C9H12N2O4S.C2H6/c10-16(12,13)11-5-7-6-14-8-3-1-2-4-9(8)15-7;1-2/h1-4,7,11H,5-6H2,(H2,10,12,13);1-2H3/t7-;/m0./s1 |
| InChIKey | GXBLLQVRBNMIFX-FJXQXJEOSA-N |
| XLogP | 0.65 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |