C12H18O2 — CID 54339181
ethane;3-ethyl-2,3-dihydro-1,4-benzodioxine (PubChem CID 54339181) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is ethane;3-ethyl-2,3-dihydro-1,4-benzodioxine.
| Compound Name | ethane;3-ethyl-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 54339181 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | ethane;3-ethyl-2,3-dihydro-1,4-benzodioxine |
| SMILES | CC.CCC1COc2ccccc2O1 |
| InChI | InChI=1S/C10H12O2.C2H6/c1-2-8-7-11-9-5-3-4-6-10(9)12-8;1-2/h3-6,8H,2,7H2,1H3;1-2H3 |
| InChIKey | TXSJKAFTOMXUKG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |