C12H15BrO2 — CID 70485741
3-(4-bromobutyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 70485741) has the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. Its IUPAC name is 3-(4-bromobutyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 3-(4-bromobutyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 70485741 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 3-(4-bromobutyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | BrCCCCC1COc2ccccc2O1 |
| InChI | InChI=1S/C12H15BrO2/c13-8-4-3-5-10-9-14-11-6-1-2-7-12(11)15-10/h1-2,6-7,10H,3-5,8-9H2 |
| InChIKey | ALKZPLFLQAOKDH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|