C20H26ClNO3 — CID 110176552
3-(2,3-dihydro-1,4-benzodioxin-3-yl)propyl-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride (PubChem CID 110176552) has the molecular formula C20H26ClNO3 and a molecular weight of 363.88 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-3-yl)propyl-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-3-yl)propyl-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride |
|---|---|
| PubChem CID | 110176552 |
| Molecular Formula | C20H26ClNO3 |
| Molecular Weight | 363.88 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-3-yl)propyl-(1-hydroxy-1-phenylpropan-2-yl)azanium chloride |
| SMILES | CC([NH2+]CCCC1COc2ccccc2O1)C(O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C20H25NO3.ClH/c1-15(20(22)16-8-3-2-4-9-16)21-13-7-10-17-14-23-18-11-5-6-12-19(18)24-17;/h2-6,8-9,11-12,15,17,20-22H,7,10,13-14H2,1H3;1H |
| InChIKey | FICBXKNUEBJQFL-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 55.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.88 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|