C14H22NO2+ — CID 7076056
butyl-[(1R)-1-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]azanium (PubChem CID 7076056) has the molecular formula C14H22NO2+ and a molecular weight of 236.33 g/mol. Its IUPAC name is butyl-[(1R)-1-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]azanium.
| Compound Name | butyl-[(1R)-1-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]azanium |
|---|---|
| PubChem CID | 7076056 |
| Molecular Formula | C14H22NO2+ |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | butyl-[(1R)-1-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]ethyl]azanium |
| SMILES | CCCC[NH2+][C@H](C)[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C14H21NO2/c1-3-4-9-15-11(2)14-10-16-12-7-5-6-8-13(12)17-14/h5-8,11,14-15H,3-4,9-10H2,1-2H3/p+1/t11-,14-/m1/s1 |
| InChIKey | XFPBCCYIVGJTOP-BXUZGUMPSA-O |
| XLogP | 1.58 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|