C14H21NO3 — CID 125480076
(1R)-2-(butylamino)-1-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]ethanol (PubChem CID 125480076) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is (1R)-2-(butylamino)-1-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]ethanol.
| Compound Name | (1R)-2-(butylamino)-1-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]ethanol |
|---|---|
| PubChem CID | 125480076 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (1R)-2-(butylamino)-1-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]ethanol |
| SMILES | CCCCNC[C@@H](O)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C14H21NO3/c1-2-3-8-15-9-11(16)14-10-17-12-6-4-5-7-13(12)18-14/h4-7,11,14-16H,2-3,8-10H2,1H3/t11-,14+/m1/s1 |
| InChIKey | YURNPUNQZNPYIF-RISCZKNCSA-N |
| XLogP | 1.58 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|