C13H20N2O2 — CID 105230267
[1-(2,3-dihydro-1,4-benzodioxin-3-yl)-2-methylbutyl]hydrazine (PubChem CID 105230267) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is [1-(2,3-dihydro-1,4-benzodioxin-3-yl)-2-methylbutyl]hydrazine.
| Compound Name | [1-(2,3-dihydro-1,4-benzodioxin-3-yl)-2-methylbutyl]hydrazine |
|---|---|
| PubChem CID | 105230267 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | [1-(2,3-dihydro-1,4-benzodioxin-3-yl)-2-methylbutyl]hydrazine |
| SMILES | CCC(C)C(NN)C1COc2ccccc2O1 |
| InChI | InChI=1S/C13H20N2O2/c1-3-9(2)13(15-14)12-8-16-10-6-4-5-7-11(10)17-12/h4-7,9,12-13,15H,3,8,14H2,1-2H3 |
| InChIKey | JYDAOJNJNHVGRI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|