C10H11ClO2 — CID 92980685
(3R)-3-(2-chloroethyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 92980685) has the molecular formula C10H11ClO2 and a molecular weight of 198.65 g/mol. Its IUPAC name is (3R)-3-(2-chloroethyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | (3R)-3-(2-chloroethyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 92980685 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | (3R)-3-(2-chloroethyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | ClCC[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C10H11ClO2/c11-6-5-8-7-12-9-3-1-2-4-10(9)13-8/h1-4,8H,5-7H2/t8-/m1/s1 |
| InChIKey | PUZFWZPNWKLEFZ-MRVPVSSYSA-N |
| XLogP | 2.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|