C9H9ClO2 — CID 736477
(3R)-3-(chloromethyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 736477) has the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. Its IUPAC name is (3R)-3-(chloromethyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | (3R)-3-(chloromethyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 736477 |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.62 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | (3R)-3-(chloromethyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | ClC[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C9H9ClO2/c10-5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,7H,5-6H2/t7-/m0/s1 |
| InChIKey | AYPKYQSHFKQVDL-ZETCQYMHSA-N |
| XLogP | 2.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.62 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|