C9H11NO2 — CID 15053
2,3-dihydro-1,4-benzodioxin-3-ylmethanamine (PubChem CID 15053) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-3-ylmethanamine.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-3-ylmethanamine |
|---|---|
| PubChem CID | 15053 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-3-ylmethanamine |
| SMILES | NCC1COc2ccccc2O1 |
| InChI | InChI=1S/C9H11NO2/c10-5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,7H,5-6,10H2 |
| InChIKey | JHNURUNMNRSGRO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |