C12H18N2O2 — CID 10680551
N'-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)propane-1,3-diamine (PubChem CID 10680551) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is N'-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)propane-1,3-diamine.
| Compound Name | N'-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 10680551 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N'-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)propane-1,3-diamine |
| SMILES | NCCCNCC1COc2ccccc2O1 |
| InChI | InChI=1S/C12H18N2O2/c13-6-3-7-14-8-10-9-15-11-4-1-2-5-12(11)16-10/h1-2,4-5,10,14H,3,6-9,13H2 |
| InChIKey | KGRXRCFWLTYCBO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|