C19H23NO2 — CID 3807074
N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-4-phenylbutan-1-amine (PubChem CID 3807074) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-4-phenylbutan-1-amine.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-4-phenylbutan-1-amine |
|---|---|
| PubChem CID | 3807074 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-4-phenylbutan-1-amine |
| SMILES | c1ccc(CCCCNCC2COc3ccccc3O2)cc1 |
| InChI | InChI=1S/C19H23NO2/c1-2-8-16(9-3-1)10-6-7-13-20-14-17-15-21-18-11-4-5-12-19(18)22-17/h1-5,8-9,11-12,17,20H,6-7,10,13-15H2 |
| InChIKey | CYKUOUAQJGHLMK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|